About (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen
(2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen (PubChem CID 143391289) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen.
Molecular Properties
| Compound Name | (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen |
| PubChem CID | 143391289 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen |
| SMILES | CC(C)C(=O)[C@H](CC1(C)CCC1)NC(C)(C)C.[H][H] |
| InChI | InChI=1S/C15H29NO.H2/c1-11(2)13(17)12(16-14(3,4)5)10-15(6)8-7-9-15;/h11-12,16H,7-10H2,1-6H3;1H/t12-;/m0./s1 |
| InChIKey | KGXKWVNTOYUOLJ-YDALLXLXSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen?
The IUPAC name of (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen (CID 143391289) is (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen.
What is the SMILES notation for (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen?
The canonical SMILES for (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen is CC(C)C(=O)[C@H](CC1(C)CCC1)NC(C)(C)C.[H][H].
What is the InChIKey of (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen?
The InChIKey is KGXKWVNTOYUOLJ-YDALLXLXSA-N. The full InChI is InChI=1S/C15H29NO.H2/c1-11(2)13(17)12(16-14(3,4)5)10-15(6)8-7-9-15;/h11-12,16H,7-10H2,1-6H3;1H/t12-;/m0./s1.
What are the key properties of (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen?
(2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen has a molecular weight of 241.42 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(tert-butylamino)-4-methyl-1-(1-methylcyclobutyl)pentan-3-one;molecular hydrogen is sourced from PubChem (CID 143391289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).