C17H28O4 — CID 143393167
2,5-dihydroxy-6-undecylcyclohex-2-ene-1,4-dione (PubChem CID 143393167) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2,5-dihydroxy-6-undecylcyclohex-2-ene-1,4-dione.
| Compound Name | 2,5-dihydroxy-6-undecylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 143393167 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2,5-dihydroxy-6-undecylcyclohex-2-ene-1,4-dione |
| SMILES | CCCCCCCCCCCC1C(=O)C(O)=CC(=O)C1O |
| InChI | InChI=1S/C17H28O4/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14(18)12-15(19)17(13)21/h12-13,16,19-20H,2-11H2,1H3 |
| InChIKey | ZNMNRBPMIDSPOK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|