C28H34FNO2 — CID 143394531
2-fluoro-4-(4-heptylphenyl)benzaldehyde;2-(2-methoxyethyl)pyridine (PubChem CID 143394531) has the molecular formula C28H34FNO2 and a molecular weight of 435.58 g/mol. Its IUPAC name is 2-fluoro-4-(4-heptylphenyl)benzaldehyde;2-(2-methoxyethyl)pyridine.
| Compound Name | 2-fluoro-4-(4-heptylphenyl)benzaldehyde;2-(2-methoxyethyl)pyridine |
|---|---|
| PubChem CID | 143394531 |
| Molecular Formula | C28H34FNO2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 2-fluoro-4-(4-heptylphenyl)benzaldehyde;2-(2-methoxyethyl)pyridine |
| SMILES | CCCCCCCc1ccc(-c2ccc(C=O)c(F)c2)cc1.COCCc1ccccn1 |
| InChI | InChI=1S/C20H23FO.C8H11NO/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-13-19(15-22)20(21)14-18;1-10-7-5-8-4-2-3-6-9-8/h8-15H,2-7H2,1H3;2-4,6H,5,7H2,1H3 |
| InChIKey | BVVUJWIHZBKSTJ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|