C22H33NO3 — CID 143394550
(2S,4S,5R,10R,17S)-5-ethyl-4,17-dihydroxy-10,13-dimethyl-3-oxo-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile (PubChem CID 143394550) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (2S,4S,5R,10R,17S)-5-ethyl-4,17-dihydroxy-10,13-dimethyl-3-oxo-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile.
| Compound Name | (2S,4S,5R,10R,17S)-5-ethyl-4,17-dihydroxy-10,13-dimethyl-3-oxo-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 143394550 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2S,4S,5R,10R,17S)-5-ethyl-4,17-dihydroxy-10,13-dimethyl-3-oxo-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2-carbonitrile |
| SMILES | CC[C@@]12CCC3C4CC[C@H](O)C4(C)CCC3[C@@]1(C)C[C@@H](C#N)C(=O)[C@H]2O |
| InChI | InChI=1S/C22H33NO3/c1-4-22-10-7-14-15-5-6-17(24)20(15,2)9-8-16(14)21(22,3)11-13(12-23)18(25)19(22)26/h13-17,19,24,26H,4-11H2,1-3H3/t13-,14?,15?,16?,17-,19+,20?,21+,22-/m0/s1 |
| InChIKey | UTFKHYLRWZMTDO-CRSGCSSDSA-N |
| XLogP | 3.46 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|