C21H29NO3 — CID 88793150
(1S,2R,4S,6S,8S,11S,12S,15S,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile (PubChem CID 88793150) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (1S,2R,4S,6S,8S,11S,12S,15S,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile.
| Compound Name | (1S,2R,4S,6S,8S,11S,12S,15S,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
|---|---|
| PubChem CID | 88793150 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (1S,2R,4S,6S,8S,11S,12S,15S,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@]45O[C@]4(C)C(=O)[C@H](C#N)C[C@]35C)[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C21H29NO3/c1-18-8-7-15-13(14(18)4-5-16(18)23)6-9-21-19(15,2)10-12(11-22)17(24)20(21,3)25-21/h12-16,23H,4-10H2,1-3H3/t12-,13-,14-,15-,16-,18-,19+,20+,21-/m0/s1 |
| InChIKey | BVWBEKKUVJYZSX-AKCOXDRMSA-N |
| XLogP | 3.23 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|