C24H31NO3 — CID 88793006
(1S,2R,4S,6S,8S,11S,12S,15R,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-15-prop-2-ynyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile (PubChem CID 88793006) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is (1S,2R,4S,6S,8S,11S,12S,15R,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-15-prop-2-ynyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile.
| Compound Name | (1S,2R,4S,6S,8S,11S,12S,15R,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-15-prop-2-ynyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
|---|---|
| PubChem CID | 88793006 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (1S,2R,4S,6S,8S,11S,12S,15R,16S)-15-hydroxy-2,6,16-trimethyl-5-oxo-15-prop-2-ynyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadecane-4-carbonitrile |
| SMILES | C#CC[C@]1(O)CC[C@H]2[C@@H]3CC[C@@]45O[C@]4(C)C(=O)[C@H](C#N)C[C@]5(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H31NO3/c1-5-9-23(27)11-8-17-16-6-12-24-21(3,18(16)7-10-20(17,23)2)13-15(14-25)19(26)22(24,4)28-24/h1,15-18,27H,6-13H2,2-4H3/t15-,16-,17-,18-,20-,21+,22+,23-,24-/m0/s1 |
| InChIKey | XGTORXBBSYOHHU-QBCHLVJCSA-N |
| XLogP | 3.62 |
| TPSA | 73.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|