C26H35NO5 — CID 88792741
[(1S,2R,6R,8S,11S,12S,15S,16S)-15-acetyloxy-4-cyano-2,6,15,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-en-5-yl] acetate (PubChem CID 88792741) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is [(1S,2R,6R,8S,11S,12S,15S,16S)-15-acetyloxy-4-cyano-2,6,15,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-en-5-yl] acetate.
| Compound Name | [(1S,2R,6R,8S,11S,12S,15S,16S)-15-acetyloxy-4-cyano-2,6,15,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-en-5-yl] acetate |
|---|---|
| PubChem CID | 88792741 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [(1S,2R,6R,8S,11S,12S,15S,16S)-15-acetyloxy-4-cyano-2,6,15,16-tetramethyl-7-oxapentacyclo[9.7.0.02,8.06,8.012,16]octadec-4-en-5-yl] acetate |
| SMILES | CC(=O)OC1=C(C#N)C[C@]2(C)[C@H]3CC[C@@]4(C)[C@@H](CC[C@]4(C)OC(C)=O)[C@@H]3CC[C@]23O[C@]13C |
| InChI | InChI=1S/C26H35NO5/c1-15(28)30-21-17(14-27)13-23(4)20-8-10-22(3)19(9-11-24(22,5)31-16(2)29)18(20)7-12-26(23)25(21,6)32-26/h18-20H,7-13H2,1-6H3/t18-,19-,20-,22-,23+,24-,25+,26-/m0/s1 |
| InChIKey | XWRJXCIULSXEFH-JDPUDKTMSA-N |
| XLogP | 4.82 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|