About N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide
N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide (PubChem CID 143394748) has the molecular formula C14H24N4O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide.
Molecular Properties
| Compound Name | N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide |
| PubChem CID | 143394748 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide |
| SMILES | CC(=O)NNc1ccc([N+](=O)[O-])cc1.CCCCCNC |
| InChI | InChI=1S/C8H9N3O3.C6H15N/c1-6(12)9-10-7-2-4-8(5-3-7)11(13)14;1-3-4-5-6-7-2/h2-5,10H,1H3,(H,9,12);7H,3-6H2,1-2H3 |
| InChIKey | IBYNSAXXPJAFAV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide?
The IUPAC name of N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide (CID 143394748) is N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide.
What is the SMILES notation for N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide?
The canonical SMILES for N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide is CC(=O)NNc1ccc([N+](=O)[O-])cc1.CCCCCNC.
What is the InChIKey of N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide?
The InChIKey is IBYNSAXXPJAFAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3.C6H15N/c1-6(12)9-10-7-2-4-8(5-3-7)11(13)14;1-3-4-5-6-7-2/h2-5,10H,1H3,(H,9,12);7H,3-6H2,1-2H3.
What are the key properties of N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide?
N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide has a molecular weight of 296.37 g/mol, XLogP of 2.45, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpentan-1-amine;N'-(4-nitrophenyl)acetohydrazide is sourced from PubChem (CID 143394748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).