C16H17BrCl2N2S — CID 143395648
6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-methyl-4-propan-2-ylpyridazine (PubChem CID 143395648) has the molecular formula C16H17BrCl2N2S and a molecular weight of 420.20 g/mol. Its IUPAC name is 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-methyl-4-propan-2-ylpyridazine.
| Compound Name | 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-methyl-4-propan-2-ylpyridazine |
|---|---|
| PubChem CID | 143395648 |
| Molecular Formula | C16H17BrCl2N2S |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | 6-[4-(2-bromoethyl)-2,6-dichlorophenyl]sulfanyl-3-methyl-4-propan-2-ylpyridazine |
| SMILES | Cc1nnc(Sc2c(Cl)cc(CCBr)cc2Cl)cc1C(C)C |
| InChI | InChI=1S/C16H17BrCl2N2S/c1-9(2)12-8-15(21-20-10(12)3)22-16-13(18)6-11(4-5-17)7-14(16)19/h6-9H,4-5H2,1-3H3 |
| InChIKey | BNSBEJZQIPJMDK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|