C28H29N3O3 — CID 143398720
3-[4-(4-methoxyphenyl)phenyl]-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 143398720) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)phenyl]-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-(4-methoxyphenyl)phenyl]-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143398720 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)phenyl]-1-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(-c2ccc(N3C(=O)CN(Cc4ccc(CN5CCCC5)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-34-26-14-10-24(11-15-26)23-8-12-25(13-9-23)31-27(32)20-30(28(31)33)19-22-6-4-21(5-7-22)18-29-16-2-3-17-29/h4-15H,2-3,16-20H2,1H3 |
| InChIKey | GRFJFYREUATALD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|