C8H9F3NO+ — CID 143399375
1-hydroxy-2,5-dimethyl-4-(trifluoromethyl)pyridin-1-ium (PubChem CID 143399375) has the molecular formula C8H9F3NO+ and a molecular weight of 192.16 g/mol. Its IUPAC name is 1-hydroxy-2,5-dimethyl-4-(trifluoromethyl)pyridin-1-ium.
| Compound Name | 1-hydroxy-2,5-dimethyl-4-(trifluoromethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 143399375 |
| Molecular Formula | C8H9F3NO+ |
| Molecular Weight | 192.16 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1-hydroxy-2,5-dimethyl-4-(trifluoromethyl)pyridin-1-ium |
| SMILES | Cc1c[n+](O)c(C)cc1C(F)(F)F |
| InChI | InChI=1S/C8H9F3NO/c1-5-4-12(13)6(2)3-7(5)8(9,10)11/h3-4,13H,1-2H3/q+1 |
| InChIKey | GXWOZASXDOLSLH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|