C10H13F3O4S2 — CID 173324954
[2,5-dimethyl-4-(trifluoromethyl)phenyl] hydrogen sulfate;methanethiol (PubChem CID 173324954) has the molecular formula C10H13F3O4S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is [2,5-dimethyl-4-(trifluoromethyl)phenyl] hydrogen sulfate;methanethiol.
| Compound Name | [2,5-dimethyl-4-(trifluoromethyl)phenyl] hydrogen sulfate;methanethiol |
|---|---|
| PubChem CID | 173324954 |
| Molecular Formula | C10H13F3O4S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | [2,5-dimethyl-4-(trifluoromethyl)phenyl] hydrogen sulfate;methanethiol |
| SMILES | CS.Cc1cc(C(F)(F)F)c(C)cc1OS(=O)(=O)O |
| InChI | InChI=1S/C9H9F3O4S.CH4S/c1-5-4-8(16-17(13,14)15)6(2)3-7(5)9(10,11)12;1-2/h3-4H,1-2H3,(H,13,14,15);2H,1H3 |
| InChIKey | JEAGBFJOLSWQRI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|