C17H28O2 — CID 143399772
ethane;7'-prop-2-enylspiro[1,3-dioxolane-2,4'-2,3,4a,5,6,8a-hexahydro-1H-naphthalene] (PubChem CID 143399772) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;7'-prop-2-enylspiro[1,3-dioxolane-2,4'-2,3,4a,5,6,8a-hexahydro-1H-naphthalene].
| Compound Name | ethane;7'-prop-2-enylspiro[1,3-dioxolane-2,4'-2,3,4a,5,6,8a-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 143399772 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;7'-prop-2-enylspiro[1,3-dioxolane-2,4'-2,3,4a,5,6,8a-hexahydro-1H-naphthalene] |
| SMILES | C=CCC1=CC2CCCC3(OCCO3)C2CC1.CC |
| InChI | InChI=1S/C15H22O2.C2H6/c1-2-4-12-6-7-14-13(11-12)5-3-8-15(14)16-9-10-17-15;1-2/h2,11,13-14H,1,3-10H2;1-2H3 |
| InChIKey | HJTIAZZBDOIJIJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|