C13H11Cl3N3O2S+ — CID 143399978
[4-chloro-2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]methyliminoazanium (PubChem CID 143399978) has the molecular formula C13H11Cl3N3O2S+ and a molecular weight of 379.68 g/mol. Its IUPAC name is [4-chloro-2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]methyliminoazanium.
| Compound Name | [4-chloro-2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]methyliminoazanium |
|---|---|
| PubChem CID | 143399978 |
| Molecular Formula | C13H11Cl3N3O2S+ |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | [4-chloro-2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]methyliminoazanium |
| SMILES | [NH2+]=NCc1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N3O2S/c14-9-2-1-8(7-18-17)13(5-9)19-22(20,21)10-3-4-11(15)12(16)6-10/h1-6,17,19H,7H2/p+1 |
| InChIKey | PDOOAUPOKYIWLS-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|