About ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene
ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene (PubChem CID 143401982) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene.
Molecular Properties
| Compound Name | ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene |
| PubChem CID | 143401982 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene |
| SMILES | C=C.C=CC=CCC.CCOC1CCNCC1O |
| InChI | InChI=1S/C7H15NO2.C6H10.C2H4/c1-2-10-7-3-4-8-5-6(7)9;1-3-5-6-4-2;1-2/h6-9H,2-5H2,1H3;3,5-6H,1,4H2,2H3;1-2H2 |
| InChIKey | UXNLVTQWRMPHJH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene?
The IUPAC name of ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene (CID 143401982) is ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene.
What is the SMILES notation for ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene?
The canonical SMILES for ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene is C=C.C=CC=CCC.CCOC1CCNCC1O.
What is the InChIKey of ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene?
The InChIKey is UXNLVTQWRMPHJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H10.C2H4/c1-2-10-7-3-4-8-5-6(7)9;1-3-5-6-4-2;1-2/h6-9H,2-5H2,1H3;3,5-6H,1,4H2,2H3;1-2H2.
What are the key properties of ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene?
ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene has a molecular weight of 255.40 g/mol, XLogP of 2.69, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-ethoxypiperidin-3-ol;hexa-1,3-diene is sourced from PubChem (CID 143401982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).