C24H20OS2 — CID 14340504
O-ethyl 1,3,3-triphenylpropa-1,2-dienylsulfanylmethanethioate (PubChem CID 14340504) has the molecular formula C24H20OS2 and a molecular weight of 388.56 g/mol. Its IUPAC name is O-ethyl 1,3,3-triphenylpropa-1,2-dienylsulfanylmethanethioate.
| Compound Name | O-ethyl 1,3,3-triphenylpropa-1,2-dienylsulfanylmethanethioate |
|---|---|
| PubChem CID | 14340504 |
| Molecular Formula | C24H20OS2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | O-ethyl 1,3,3-triphenylpropa-1,2-dienylsulfanylmethanethioate |
| SMILES | CCOC(=S)SC(=C=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20OS2/c1-2-25-24(26)27-23(21-16-10-5-11-17-21)18-22(19-12-6-3-7-13-19)20-14-8-4-9-15-20/h3-17H,2H2,1H3 |
| InChIKey | XHWHZHQGBGFEBW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|