C21H19N3O3S — CID 143409460
3,4-dimethoxy-N-[3-[(E)-(3-sulfanyl-2-pyridinyl)iminomethyl]phenyl]benzamide (PubChem CID 143409460) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-[(E)-(3-sulfanyl-2-pyridinyl)iminomethyl]phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-[(E)-(3-sulfanyl-2-pyridinyl)iminomethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 143409460 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3,4-dimethoxy-N-[3-[(E)-(3-sulfanyl-2-pyridinyl)iminomethyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(/C=N/c3ncccc3S)c2)cc1OC |
| InChI | InChI=1S/C21H19N3O3S/c1-26-17-9-8-15(12-18(17)27-2)21(25)24-16-6-3-5-14(11-16)13-23-20-19(28)7-4-10-22-20/h3-13,28H,1-2H3,(H,24,25)/b23-13+ |
| InChIKey | XJMIXQCWAPDSAJ-YDZHTSKRSA-N |
| XLogP | 4.39 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|