C24H31FN2O3 — CID 143410224
ethane;1-[3-[(3-fluoro-4-methylphenoxy)methyl]-4-morpholin-4-ylphenyl]pyrrolidin-2-one (PubChem CID 143410224) has the molecular formula C24H31FN2O3 and a molecular weight of 414.52 g/mol. Its IUPAC name is ethane;1-[3-[(3-fluoro-4-methylphenoxy)methyl]-4-morpholin-4-ylphenyl]pyrrolidin-2-one.
| Compound Name | ethane;1-[3-[(3-fluoro-4-methylphenoxy)methyl]-4-morpholin-4-ylphenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143410224 |
| Molecular Formula | C24H31FN2O3 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | ethane;1-[3-[(3-fluoro-4-methylphenoxy)methyl]-4-morpholin-4-ylphenyl]pyrrolidin-2-one |
| SMILES | CC.Cc1ccc(OCc2cc(N3CCCC3=O)ccc2N2CCOCC2)cc1F |
| InChI | InChI=1S/C22H25FN2O3.C2H6/c1-16-4-6-19(14-20(16)23)28-15-17-13-18(25-8-2-3-22(25)26)5-7-21(17)24-9-11-27-12-10-24;1-2/h4-7,13-14H,2-3,8-12,15H2,1H3;1-2H3 |
| InChIKey | RXPBCRHXJQQALD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|