C17H22ClN3O5 — CID 143411587
4-amino-1-[5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one;(4-chlorophenyl)methanediol (PubChem CID 143411587) has the molecular formula C17H22ClN3O5 and a molecular weight of 383.83 g/mol. Its IUPAC name is 4-amino-1-[5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one;(4-chlorophenyl)methanediol.
| Compound Name | 4-amino-1-[5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one;(4-chlorophenyl)methanediol |
|---|---|
| PubChem CID | 143411587 |
| Molecular Formula | C17H22ClN3O5 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-amino-1-[5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrimidin-2-one;(4-chlorophenyl)methanediol |
| SMILES | CC1CC(CO)OC1n1ccc(N)nc1=O.OC(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H15N3O3.C7H7ClO2/c1-6-4-7(5-14)16-9(6)13-3-2-8(11)12-10(13)15;8-6-3-1-5(2-4-6)7(9)10/h2-3,6-7,9,14H,4-5H2,1H3,(H2,11,12,15);1-4,7,9-10H |
| InChIKey | KUHCCHGWAFURFR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|