C19H24ClN4O4PS — CID 143708479
2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxyphosphanyl-(4-chlorophenyl)sulfanylamino]propanal (PubChem CID 143708479) has the molecular formula C19H24ClN4O4PS and a molecular weight of 470.92 g/mol. Its IUPAC name is 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxyphosphanyl-(4-chlorophenyl)sulfanylamino]propanal.
| Compound Name | 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxyphosphanyl-(4-chlorophenyl)sulfanylamino]propanal |
|---|---|
| PubChem CID | 143708479 |
| Molecular Formula | C19H24ClN4O4PS |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.09 |
| IUPAC Name | 2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxyphosphanyl-(4-chlorophenyl)sulfanylamino]propanal |
| SMILES | CC1CC(COPN(Sc2ccc(Cl)cc2)C(C)C=O)OC1n1ccc(N)nc1=O |
| InChI | InChI=1S/C19H24ClN4O4PS/c1-12-9-15(28-18(12)23-8-7-17(21)22-19(23)26)11-27-29-24(13(2)10-25)30-16-5-3-14(20)4-6-16/h3-8,10,12-13,15,18,29H,9,11H2,1-2H3,(H2,21,22,26) |
| InChIKey | FUDOKZRJJVOADH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|