C17H21N3O5P+ — CID 123340855
1-[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]ethoxy-oxo-phenoxyphosphanium (PubChem CID 123340855) has the molecular formula C17H21N3O5P+ and a molecular weight of 378.35 g/mol. Its IUPAC name is 1-[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]ethoxy-oxo-phenoxyphosphanium.
| Compound Name | 1-[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]ethoxy-oxo-phenoxyphosphanium |
|---|---|
| PubChem CID | 123340855 |
| Molecular Formula | C17H21N3O5P+ |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-[5-(4-amino-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]ethoxy-oxo-phenoxyphosphanium |
| SMILES | CC1CC(C(C)O[P+](=O)Oc2ccccc2)OC1n1ccc(N)nc1=O |
| InChI | InChI=1S/C17H20N3O5P/c1-11-10-14(23-16(11)20-9-8-15(18)19-17(20)21)12(2)24-26(22)25-13-6-4-3-5-7-13/h3-9,11-12,14,16H,10H2,1-2H3,(H-,18,19,21)/p+1 |
| InChIKey | GIVGBPIQOGBLLY-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|