C25H31N3O2S — CID 143411810
4-[2-(diethylamino)ethoxy]-N-methyl-2-[C-(methylidene-naphthalen-1-yl-oxo-λ6-sulfanyl)carbonimidoyl]aniline (PubChem CID 143411810) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is 4-[2-(diethylamino)ethoxy]-N-methyl-2-[C-(methylidene-naphthalen-1-yl-oxo-λ6-sulfanyl)carbonimidoyl]aniline.
| Compound Name | 4-[2-(diethylamino)ethoxy]-N-methyl-2-[C-(methylidene-naphthalen-1-yl-oxo-λ6-sulfanyl)carbonimidoyl]aniline |
|---|---|
| PubChem CID | 143411810 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 4-[2-(diethylamino)ethoxy]-N-methyl-2-[C-(methylidene-naphthalen-1-yl-oxo-λ6-sulfanyl)carbonimidoyl]aniline |
| SMILES | [H]/N=C(\c1cc(OCCN(CC)CC)ccc1NC)S(=C)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H31N3O2S/c1-5-28(6-2)16-17-30-20-14-15-23(27-3)22(18-20)25(26)31(4,29)24-13-9-11-19-10-7-8-12-21(19)24/h7-15,18,26-27H,4-6,16-17H2,1-3H3/b26-25+ |
| InChIKey | QDLXERZIAGWBMD-OCEACIFDSA-N |
| XLogP | 4.70 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|