C33H30N2O6S2 — CID 89378366
2-[4-(benzylamino)-3-(C-naphthalen-1-ylsulfonylcarbonimidoyl)phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 89378366) has the molecular formula C33H30N2O6S2 and a molecular weight of 614.75 g/mol. Its IUPAC name is 2-[4-(benzylamino)-3-(C-naphthalen-1-ylsulfonylcarbonimidoyl)phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-(benzylamino)-3-(C-naphthalen-1-ylsulfonylcarbonimidoyl)phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89378366 |
| Molecular Formula | C33H30N2O6S2 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | 2-[4-(benzylamino)-3-(C-naphthalen-1-ylsulfonylcarbonimidoyl)phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | [H]/N=C(\c1cc(OCCOS(=O)(=O)c2ccc(C)cc2)ccc1NCc1ccccc1)S(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H30N2O6S2/c1-24-14-17-28(18-15-24)43(38,39)41-21-20-40-27-16-19-31(35-23-25-8-3-2-4-9-25)30(22-27)33(34)42(36,37)32-13-7-11-26-10-5-6-12-29(26)32/h2-19,22,34-35H,20-21,23H2,1H3/b34-33+ |
| InChIKey | DAXIGOZFOGLFDD-JEIPZWNWSA-N |
| XLogP | 6.34 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|