C24H32N4O — CID 143412945
7,7-dipropyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one;ethane (PubChem CID 143412945) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 7,7-dipropyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one;ethane.
| Compound Name | 7,7-dipropyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one;ethane |
|---|---|
| PubChem CID | 143412945 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 7,7-dipropyl-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaen-6-one;ethane |
| SMILES | CC.CCCC1(CCC)C(=O)Nc2cc3c4c([nH]c3cc21)-c1[nH]ncc1CCC4 |
| InChI | InChI=1S/C22H26N4O.C2H6/c1-3-8-22(9-4-2)16-11-17-15(10-18(16)25-21(22)27)14-7-5-6-13-12-23-26-19(13)20(14)24-17;1-2/h10-12,24H,3-9H2,1-2H3,(H,23,26)(H,25,27);1-2H3 |
| InChIKey | CZCXUJFZQCJGTG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|