C23H26N4O — CID 135961270
5-ethylspiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaene-7,1'-cyclohexane]-6-one (PubChem CID 135961270) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-ethylspiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaene-7,1'-cyclohexane]-6-one.
| Compound Name | 5-ethylspiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaene-7,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 135961270 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 5-ethylspiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13(17),15-hexaene-7,1'-cyclohexane]-6-one |
| SMILES | CCN1C(=O)C2(CCCCC2)c2cc3[nH]c4c(c3cc21)CCCc1cn[nH]c1-4 |
| InChI | InChI=1S/C23H26N4O/c1-2-27-19-11-16-15-8-6-7-14-13-24-26-20(14)21(15)25-18(16)12-17(19)23(22(27)28)9-4-3-5-10-23/h11-13,25H,2-10H2,1H3,(H,24,26) |
| InChIKey | IRWDCENHFIIAGN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|