C28H38N4O3Si — CID 135961426
5-ethyl-15-(2-trimethylsilylethoxymethyl)spiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaene-7,4'-oxane]-6-one (PubChem CID 135961426) has the molecular formula C28H38N4O3Si and a molecular weight of 506.72 g/mol. Its IUPAC name is 5-ethyl-15-(2-trimethylsilylethoxymethyl)spiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaene-7,4'-oxane]-6-one.
| Compound Name | 5-ethyl-15-(2-trimethylsilylethoxymethyl)spiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaene-7,4'-oxane]-6-one |
|---|---|
| PubChem CID | 135961426 |
| Molecular Formula | C28H38N4O3Si |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 5-ethyl-15-(2-trimethylsilylethoxymethyl)spiro[5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaene-7,4'-oxane]-6-one |
| SMILES | CCN1C(=O)C2(CCOCC2)c2cc3[nH]c4c(c3cc21)CCCc1cn(COCC[Si](C)(C)C)nc1-4 |
| InChI | InChI=1S/C28H38N4O3Si/c1-5-32-24-15-21-20-8-6-7-19-17-31(18-35-13-14-36(2,3)4)30-25(19)26(20)29-23(21)16-22(24)28(27(32)33)9-11-34-12-10-28/h15-17,29H,5-14,18H2,1-4H3 |
| InChIKey | WCMHDVKROBVXAG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|