C32H46N4O4Si — CID 135961380
ethyl 2-[6-oxo-7,7-dipropyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-5-yl]acetate (PubChem CID 135961380) has the molecular formula C32H46N4O4Si and a molecular weight of 578.83 g/mol. Its IUPAC name is ethyl 2-[6-oxo-7,7-dipropyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-5-yl]acetate.
| Compound Name | ethyl 2-[6-oxo-7,7-dipropyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-5-yl]acetate |
|---|---|
| PubChem CID | 135961380 |
| Molecular Formula | C32H46N4O4Si |
| Molecular Weight | 578.83 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | ethyl 2-[6-oxo-7,7-dipropyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-5-yl]acetate |
| SMILES | CCCC1(CCC)C(=O)N(CC(=O)OCC)c2cc3c4c([nH]c3cc21)-c1nn(COCC[Si](C)(C)C)cc1CCC4 |
| InChI | InChI=1S/C32H46N4O4Si/c1-7-13-32(14-8-2)25-18-26-24(17-27(25)36(31(32)38)20-28(37)40-9-3)23-12-10-11-22-19-35(34-29(22)30(23)33-26)21-39-15-16-41(4,5)6/h17-19,33H,7-16,20-21H2,1-6H3 |
| InChIKey | QNJNHXNKBMCZFF-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.83 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|