C27H36N4O2Si — CID 135961213
7,7-dimethyl-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one (PubChem CID 135961213) has the molecular formula C27H36N4O2Si and a molecular weight of 476.70 g/mol. Its IUPAC name is 7,7-dimethyl-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one.
| Compound Name | 7,7-dimethyl-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
|---|---|
| PubChem CID | 135961213 |
| Molecular Formula | C27H36N4O2Si |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 7,7-dimethyl-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-6-one |
| SMILES | C=CCN1C(=O)C(C)(C)c2cc3[nH]c4c(c3cc21)CCCc1cn(COCC[Si](C)(C)C)nc1-4 |
| InChI | InChI=1S/C27H36N4O2Si/c1-7-11-31-23-14-20-19-10-8-9-18-16-30(17-33-12-13-34(4,5)6)29-24(18)25(19)28-22(20)15-21(23)27(2,3)26(31)32/h7,14-16,28H,1,8-13,17H2,2-6H3 |
| InChIKey | PJUDBBSIFJEDLG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|