C33H44N4O6Si — CID 135961393
ethyl 2-[7-(2-ethoxy-2-oxoethyl)-6-oxo-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-7-yl]acetate (PubChem CID 135961393) has the molecular formula C33H44N4O6Si and a molecular weight of 620.82 g/mol. Its IUPAC name is ethyl 2-[7-(2-ethoxy-2-oxoethyl)-6-oxo-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-7-yl]acetate.
| Compound Name | ethyl 2-[7-(2-ethoxy-2-oxoethyl)-6-oxo-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-7-yl]acetate |
|---|---|
| PubChem CID | 135961393 |
| Molecular Formula | C33H44N4O6Si |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | ethyl 2-[7-(2-ethoxy-2-oxoethyl)-6-oxo-5-prop-2-enyl-15-(2-trimethylsilylethoxymethyl)-5,11,14,15-tetrazapentacyclo[10.8.0.02,10.04,8.013,17]icosa-1(12),2,4(8),9,13,16-hexaen-7-yl]acetate |
| SMILES | C=CCN1C(=O)C(CC(=O)OCC)(CC(=O)OCC)c2cc3[nH]c4c(c3cc21)CCCc1cn(COCC[Si](C)(C)C)nc1-4 |
| InChI | InChI=1S/C33H44N4O6Si/c1-7-13-37-27-16-24-23-12-10-11-22-20-36(21-41-14-15-44(4,5)6)35-30(22)31(23)34-26(24)17-25(27)33(32(37)40,18-28(38)42-8-2)19-29(39)43-9-3/h7,16-17,20,34H,1,8-15,18-19,21H2,2-6H3 |
| InChIKey | YHARVAXPCXCMJO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 115.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|