C28H23N3O6 — CID 143413080
6-(3-cyanophenyl)-2-[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]quinoline-4-carboxylic acid;formamide (PubChem CID 143413080) has the molecular formula C28H23N3O6 and a molecular weight of 497.51 g/mol. Its IUPAC name is 6-(3-cyanophenyl)-2-[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]quinoline-4-carboxylic acid;formamide.
| Compound Name | 6-(3-cyanophenyl)-2-[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]quinoline-4-carboxylic acid;formamide |
|---|---|
| PubChem CID | 143413080 |
| Molecular Formula | C28H23N3O6 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 6-(3-cyanophenyl)-2-[3-(4-hydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]quinoline-4-carboxylic acid;formamide |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)c1cc(C(=O)O)c2cc(-c3cccc(C#N)c3)ccc2n1.NC=O |
| InChI | InChI=1S/C27H20N2O5.CH3NO/c1-34-27(33)23(12-16-5-8-20(30)9-6-16)25-14-22(26(31)32)21-13-19(7-10-24(21)29-25)18-4-2-3-17(11-18)15-28;2-1-3/h2-11,13-14,23,30H,12H2,1H3,(H,31,32);1H,(H2,2,3) |
| InChIKey | HOYKGAZJRAWXNP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|