C15H23N3OS2 — CID 143416809
N-(2-aminoethyl)-N-ethyl-7-methoxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carbothioamide (PubChem CID 143416809) has the molecular formula C15H23N3OS2 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-ethyl-7-methoxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carbothioamide.
| Compound Name | N-(2-aminoethyl)-N-ethyl-7-methoxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carbothioamide |
|---|---|
| PubChem CID | 143416809 |
| Molecular Formula | C15H23N3OS2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(2-aminoethyl)-N-ethyl-7-methoxy-3,5-dihydro-2H-1,4-benzothiazepine-4-carbothioamide |
| SMILES | CCN(CCN)C(=S)N1CCSc2ccc(OC)cc2C1 |
| InChI | InChI=1S/C15H23N3OS2/c1-3-17(7-6-16)15(20)18-8-9-21-14-5-4-13(19-2)10-12(14)11-18/h4-5,10H,3,6-9,11,16H2,1-2H3 |
| InChIKey | CSHNFAGHVIWXRM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|