C13H15NO4S — CID 25144728
tritiomethyl 2-oxo-2-[7-(tritiomethoxy)-3,5-dihydro-2H-1,4-benzothiazepin-4-yl]acetate (PubChem CID 25144728) has the molecular formula C13H15NO4S and a molecular weight of 285.35 g/mol. Its IUPAC name is tritiomethyl 2-oxo-2-[7-(tritiomethoxy)-3,5-dihydro-2H-1,4-benzothiazepin-4-yl]acetate.
| Compound Name | tritiomethyl 2-oxo-2-[7-(tritiomethoxy)-3,5-dihydro-2H-1,4-benzothiazepin-4-yl]acetate |
|---|---|
| PubChem CID | 25144728 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | tritiomethyl 2-oxo-2-[7-(tritiomethoxy)-3,5-dihydro-2H-1,4-benzothiazepin-4-yl]acetate |
| SMILES | [3H]COC(=O)C(=O)N1CCSc2ccc(OC[3H])cc2C1 |
| InChI | InChI=1S/C13H15NO4S/c1-17-10-3-4-11-9(7-10)8-14(5-6-19-11)12(15)13(16)18-2/h3-4,7H,5-6,8H2,1-2H3/i1T,2T |
| InChIKey | HIDICJPAUXSRDS-RVQWGROCSA-N |
| XLogP | 1.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|