C23H29N5O4S3 — CID 143628939
2,4-diamino-N-[2-[2-[[2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetyl]amino]ethyldisulfanyl]ethyl]benzamide (PubChem CID 143628939) has the molecular formula C23H29N5O4S3 and a molecular weight of 535.72 g/mol. Its IUPAC name is 2,4-diamino-N-[2-[2-[[2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetyl]amino]ethyldisulfanyl]ethyl]benzamide.
| Compound Name | 2,4-diamino-N-[2-[2-[[2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetyl]amino]ethyldisulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 143628939 |
| Molecular Formula | C23H29N5O4S3 |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 2,4-diamino-N-[2-[2-[[2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetyl]amino]ethyldisulfanyl]ethyl]benzamide |
| SMILES | COc1ccc2c(c1)CN(C(=O)C(=O)NCCSSCCNC(=O)c1ccc(N)cc1N)CCS2 |
| InChI | InChI=1S/C23H29N5O4S3/c1-32-17-3-5-20-15(12-17)14-28(8-11-33-20)23(31)22(30)27-7-10-35-34-9-6-26-21(29)18-4-2-16(24)13-19(18)25/h2-5,12-13H,6-11,14,24-25H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | PSUTZXOKHHWZMX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|