About 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane
2-[(dimethylamino)methyl]oxane-2,3-diol;ethane (PubChem CID 143418563) has the molecular formula C12H29NO3
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane |
| PubChem CID | 143418563 |
| Molecular Formula | C12H29NO3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.21 |
| IUPAC Name | 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane |
| SMILES | CC.CC.CN(C)CC1(O)OCCCC1O |
| InChI | InChI=1S/C8H17NO3.2C2H6/c1-9(2)6-8(11)7(10)4-3-5-12-8;2*1-2/h7,10-11H,3-6H2,1-2H3;2*1-2H3 |
| InChIKey | LRSGWAGOIXVSNA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane?
The IUPAC name of 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane (CID 143418563) is 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane.
What is the SMILES notation for 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane?
The canonical SMILES for 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane is CC.CC.CN(C)CC1(O)OCCCC1O.
What is the InChIKey of 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane?
The InChIKey is LRSGWAGOIXVSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3.2C2H6/c1-9(2)6-8(11)7(10)4-3-5-12-8;2*1-2/h7,10-11H,3-6H2,1-2H3;2*1-2H3.
What are the key properties of 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane?
2-[(dimethylamino)methyl]oxane-2,3-diol;ethane has a molecular weight of 235.37 g/mol, XLogP of 1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]oxane-2,3-diol;ethane is sourced from PubChem (CID 143418563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).