C16H18FN3O3 — CID 143418586
3-(fluoroamino)-N-(4-methyl-2-oxo-1H-quinolin-7-yl)-2-oxohexanamide (PubChem CID 143418586) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 3-(fluoroamino)-N-(4-methyl-2-oxo-1H-quinolin-7-yl)-2-oxohexanamide.
| Compound Name | 3-(fluoroamino)-N-(4-methyl-2-oxo-1H-quinolin-7-yl)-2-oxohexanamide |
|---|---|
| PubChem CID | 143418586 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-(fluoroamino)-N-(4-methyl-2-oxo-1H-quinolin-7-yl)-2-oxohexanamide |
| SMILES | CCCC(NF)C(=O)C(=O)Nc1ccc2c(C)cc(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H18FN3O3/c1-3-4-12(20-17)15(22)16(23)18-10-5-6-11-9(2)7-14(21)19-13(11)8-10/h5-8,12,20H,3-4H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | OYANOYWRLMLHSS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|