C20H27BrOSi- — CID 143419840
CID 143419840 (PubChem CID 143419840) has the molecular formula C20H27BrOSi- and a molecular weight of 391.43 g/mol.
| Compound Name | CID 143419840 |
|---|---|
| PubChem CID | 143419840 |
| Molecular Formula | C20H27BrOSi- |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | — |
| SMILES | Cc1ccc(Br)cc1Cc1ccc(O[Si-](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H27BrOSi/c1-15-7-10-18(21)14-17(15)13-16-8-11-19(12-9-16)22-23(5,6)20(2,3)4/h7-12,14H,13H2,1-6H3/q-1 |
| InChIKey | ZMCRKMPUMVROLW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|