About methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate
methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate (PubChem CID 143419882) has the molecular formula C9H14F2O3
and a molecular weight of 208.20 g/mol. Its IUPAC name is methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate.
Analyze methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate?
The IUPAC name of methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate (CID 143419882) is methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate?
The canonical SMILES for methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate is COC(=O)C1CCC(OCC(F)F)C1.
What is the InChIKey of methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate?
The InChIKey is KEYJPEFUTLYBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O3/c1-13-9(12)6-2-3-7(4-6)14-5-8(10)11/h6-8H,2-5H2,1H3.
What are the key properties of methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate?
methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate has a molecular weight of 208.20 g/mol, XLogP of 1.61, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-difluoroethoxy)cyclopentane-1-carboxylate is sourced from PubChem (CID 143419882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).