C14H27FO3Si — CID 86626207
ethyl (1S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentane-1-carboxylate (PubChem CID 86626207) has the molecular formula C14H27FO3Si and a molecular weight of 290.45 g/mol. Its IUPAC name is ethyl (1S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 86626207 |
| Molecular Formula | C14H27FO3Si |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl (1S,3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](F)C1 |
| InChI | InChI=1S/C14H27FO3Si/c1-7-17-13(16)10-8-11(15)12(9-10)18-19(5,6)14(2,3)4/h10-12H,7-9H2,1-6H3/t10-,11+,12+/m1/s1 |
| InChIKey | CXYHKKIHJAHHMB-WOPDTQHZSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|