C19H16F2N5O2S+ — CID 143422536
2-[3-(1,1-difluoroethyl)phenyl]-3-(2-methylsulfonylpyrimidin-4-yl)-1H-imidazo[1,2-a]pyrazin-4-ium (PubChem CID 143422536) has the molecular formula C19H16F2N5O2S+ and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[3-(1,1-difluoroethyl)phenyl]-3-(2-methylsulfonylpyrimidin-4-yl)-1H-imidazo[1,2-a]pyrazin-4-ium.
| Compound Name | 2-[3-(1,1-difluoroethyl)phenyl]-3-(2-methylsulfonylpyrimidin-4-yl)-1H-imidazo[1,2-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 143422536 |
| Molecular Formula | C19H16F2N5O2S+ |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[3-(1,1-difluoroethyl)phenyl]-3-(2-methylsulfonylpyrimidin-4-yl)-1H-imidazo[1,2-a]pyrazin-4-ium |
| SMILES | CC(F)(F)c1cccc(-c2[nH]c3cncc[n+]3c2-c2ccnc(S(C)(=O)=O)n2)c1 |
| InChI | InChI=1S/C19H15F2N5O2S/c1-19(20,21)13-5-3-4-12(10-13)16-17(26-9-8-22-11-15(26)25-16)14-6-7-23-18(24-14)29(2,27)28/h3-11H,1-2H3/p+1 |
| InChIKey | LUDQUVNTZOIFRC-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|