C22H23ClF3N3O — CID 143422658
1-[7-chloro-6-[[4-(C,N-dimethylcarbonimidoyl)phenyl]methylamino]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone (PubChem CID 143422658) has the molecular formula C22H23ClF3N3O and a molecular weight of 437.89 g/mol. Its IUPAC name is 1-[7-chloro-6-[[4-(C,N-dimethylcarbonimidoyl)phenyl]methylamino]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-chloro-6-[[4-(C,N-dimethylcarbonimidoyl)phenyl]methylamino]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 143422658 |
| Molecular Formula | C22H23ClF3N3O |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 1-[7-chloro-6-[[4-(C,N-dimethylcarbonimidoyl)phenyl]methylamino]-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone |
| SMILES | C/N=C(\C)c1ccc(CNc2c(Cl)ccc3c2CCN(C(=O)C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C22H23ClF3N3O/c1-14(27-2)16-5-3-15(4-6-16)13-28-20-18-10-12-29(21(30)22(24,25)26)11-9-17(18)7-8-19(20)23/h3-8,28H,9-13H2,1-2H3/b27-14+ |
| InChIKey | KCAPMMXIXDMKHY-MZJWZYIUSA-N |
| XLogP | 4.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|