C22H23ClF3N3O2S — CID 58495608
S-[4-[[[7-chloro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]methyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 58495608) has the molecular formula C22H23ClF3N3O2S and a molecular weight of 485.96 g/mol. Its IUPAC name is S-[4-[[[7-chloro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]methyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[[7-chloro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]methyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 58495608 |
| Molecular Formula | C22H23ClF3N3O2S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | S-[4-[[[7-chloro-3-(2,2,2-trifluoroacetyl)-1,2,4,5-tetrahydro-3-benzazepin-6-yl]amino]methyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(CNc2c(Cl)ccc3c2CCN(C(=O)C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C22H23ClF3N3O2S/c1-28(2)21(31)32-16-6-3-14(4-7-16)13-27-19-17-10-12-29(20(30)22(24,25)26)11-9-15(17)5-8-18(19)23/h3-8,27H,9-13H2,1-2H3 |
| InChIKey | NSHSOEOZFCYJDM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|