C17H21F6NO4S — CID 143422817
ethane;[8-methyl-3-(2,2,2-trifluoroacetyl)-2,4,5,6-tetrahydro-1H-3-benzazocin-7-yl] trifluoromethanesulfonate (PubChem CID 143422817) has the molecular formula C17H21F6NO4S and a molecular weight of 449.41 g/mol. Its IUPAC name is ethane;[8-methyl-3-(2,2,2-trifluoroacetyl)-2,4,5,6-tetrahydro-1H-3-benzazocin-7-yl] trifluoromethanesulfonate.
| Compound Name | ethane;[8-methyl-3-(2,2,2-trifluoroacetyl)-2,4,5,6-tetrahydro-1H-3-benzazocin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 143422817 |
| Molecular Formula | C17H21F6NO4S |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | ethane;[8-methyl-3-(2,2,2-trifluoroacetyl)-2,4,5,6-tetrahydro-1H-3-benzazocin-7-yl] trifluoromethanesulfonate |
| SMILES | CC.Cc1ccc2c(c1OS(=O)(=O)C(F)(F)F)CCCN(C(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C15H15F6NO4S.C2H6/c1-9-4-5-10-6-8-22(13(23)14(16,17)18)7-2-3-11(10)12(9)26-27(24,25)15(19,20)21;1-2/h4-5H,2-3,6-8H2,1H3;1-2H3 |
| InChIKey | OEQMFELCDQEKCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|