C12H11F3NO3S- — CID 91369268
5-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-8-sulfinate (PubChem CID 91369268) has the molecular formula C12H11F3NO3S- and a molecular weight of 306.28 g/mol. Its IUPAC name is 5-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-8-sulfinate.
| Compound Name | 5-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-8-sulfinate |
|---|---|
| PubChem CID | 91369268 |
| Molecular Formula | C12H11F3NO3S- |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-methyl-2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinoline-8-sulfinate |
| SMILES | Cc1ccc(S(=O)[O-])c2c1CCN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C12H12F3NO3S/c1-7-2-3-10(20(18)19)9-6-16(5-4-8(7)9)11(17)12(13,14)15/h2-3H,4-6H2,1H3,(H,18,19)/p-1 |
| InChIKey | QDPXSLYUQAUYBW-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|