C24H26Br2F6N2O2 — CID 157475968
1-(7-bromo-5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone;N-[2-(4-bromo-2-methylphenyl)ethyl]-2,2,2-trifluoroacetamide;methane (PubChem CID 157475968) has the molecular formula C24H26Br2F6N2O2 and a molecular weight of 648.28 g/mol. Its IUPAC name is 1-(7-bromo-5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone;N-[2-(4-bromo-2-methylphenyl)ethyl]-2,2,2-trifluoroacetamide;methane.
| Compound Name | 1-(7-bromo-5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone;N-[2-(4-bromo-2-methylphenyl)ethyl]-2,2,2-trifluoroacetamide;methane |
|---|---|
| PubChem CID | 157475968 |
| Molecular Formula | C24H26Br2F6N2O2 |
| Molecular Weight | 648.28 g/mol |
| Exact Mass | 646.03 |
| IUPAC Name | 1-(7-bromo-5-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-2,2,2-trifluoroethanone;N-[2-(4-bromo-2-methylphenyl)ethyl]-2,2,2-trifluoroacetamide;methane |
| SMILES | C.Cc1cc(Br)cc2c1CCN(C(=O)C(F)(F)F)C2.Cc1cc(Br)ccc1CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11BrF3NO.C11H11BrF3NO.CH4/c1-7-4-9(13)5-8-6-17(3-2-10(7)8)11(18)12(14,15)16;1-7-6-9(12)3-2-8(7)4-5-16-10(17)11(13,14)15;/h4-5H,2-3,6H2,1H3;2-3,6H,4-5H2,1H3,(H,16,17);1H4 |
| InChIKey | BVPBHXPQFOYTPW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.28 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |