C32H28F6N2O2 — CID 101028022
2,2,2-trifluoro-1-[6,7,25,26-tetramethyl-10-(2,2,2-trifluoroacetyl)-3,10-diazapentacyclo[10.6.6.25,8.013,18.019,24]hexacosa-1(18),5,7,12,14,16,19,21,23,25-decaen-3-yl]ethanone (PubChem CID 101028022) has the molecular formula C32H28F6N2O2 and a molecular weight of 586.58 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[6,7,25,26-tetramethyl-10-(2,2,2-trifluoroacetyl)-3,10-diazapentacyclo[10.6.6.25,8.013,18.019,24]hexacosa-1(18),5,7,12,14,16,19,21,23,25-decaen-3-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[6,7,25,26-tetramethyl-10-(2,2,2-trifluoroacetyl)-3,10-diazapentacyclo[10.6.6.25,8.013,18.019,24]hexacosa-1(18),5,7,12,14,16,19,21,23,25-decaen-3-yl]ethanone |
|---|---|
| PubChem CID | 101028022 |
| Molecular Formula | C32H28F6N2O2 |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 2,2,2-trifluoro-1-[6,7,25,26-tetramethyl-10-(2,2,2-trifluoroacetyl)-3,10-diazapentacyclo[10.6.6.25,8.013,18.019,24]hexacosa-1(18),5,7,12,14,16,19,21,23,25-decaen-3-yl]ethanone |
| SMILES | Cc1c(C)c2c(C)c(C)c1CN(C(=O)C(F)(F)F)Cc1c3ccccc3c(c3ccccc13)CN(C(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C32H28F6N2O2/c1-17-18(2)26-14-40(30(42)32(36,37)38)16-28-23-11-7-5-9-21(23)27(22-10-6-8-12-24(22)28)15-39(29(41)31(33,34)35)13-25(17)19(3)20(26)4/h5-12H,13-16H2,1-4H3 |
| InChIKey | QSIOCUHDXYEYSM-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|