C53H60N2 — CID 143423752
1-[4-[4-[[4-[4-[3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrol-1-yl]cyclohexa-1,5-dien-1-yl]phenyl]methyl]phenyl]phenyl]-3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrole (PubChem CID 143423752) has the molecular formula C53H60N2 and a molecular weight of 725.08 g/mol. Its IUPAC name is 1-[4-[4-[[4-[4-[3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrol-1-yl]cyclohexa-1,5-dien-1-yl]phenyl]methyl]phenyl]phenyl]-3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrole.
| Compound Name | 1-[4-[4-[[4-[4-[3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrol-1-yl]cyclohexa-1,5-dien-1-yl]phenyl]methyl]phenyl]phenyl]-3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrole |
|---|---|
| PubChem CID | 143423752 |
| Molecular Formula | C53H60N2 |
| Molecular Weight | 725.08 g/mol |
| Exact Mass | 724.48 |
| IUPAC Name | 1-[4-[4-[[4-[4-[3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrol-1-yl]cyclohexa-1,5-dien-1-yl]phenyl]methyl]phenyl]phenyl]-3,4-diethyl-2,5-bis[(Z)-prop-1-enyl]pyrrole |
| SMILES | C/C=C\c1c(CC)c(CC)c(/C=C\C)n1-c1ccc(-c2ccc(Cc3ccc(C4=CCC(n5c(/C=C\C)c(CC)c(CC)c5/C=C\C)C=C4)cc3)cc2)cc1 |
| InChI | InChI=1S/C53H60N2/c1-9-17-50-46(13-5)47(14-6)51(18-10-2)54(50)44-33-29-42(30-34-44)40-25-21-38(22-26-40)37-39-23-27-41(28-24-39)43-31-35-45(36-32-43)55-52(19-11-3)48(15-7)49(16-8)53(55)20-12-4/h9-12,17-35,45H,13-16,36-37H2,1-8H3/b17-9-,18-10-,19-11-,20-12- |
| InChIKey | OXIRLIYKKHQREF-MQDKSMIDSA-N |
| XLogP | 14.50 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.08 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |