C38H29N3 — CID 146339497
3-carbazol-9-yl-5-[4-[3-ethyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile (PubChem CID 146339497) has the molecular formula C38H29N3 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-carbazol-9-yl-5-[4-[3-ethyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile.
| Compound Name | 3-carbazol-9-yl-5-[4-[3-ethyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 146339497 |
| Molecular Formula | C38H29N3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 3-carbazol-9-yl-5-[4-[3-ethyl-2-[(Z)-prop-1-enyl]indol-1-yl]phenyl]benzonitrile |
| SMILES | C/C=C\c1c(CC)c2ccccc2n1-c1ccc(-c2cc(C#N)cc(-n3c4ccccc4c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C38H29N3/c1-3-11-35-31(4-2)32-12-5-8-15-36(32)40(35)29-20-18-27(19-21-29)28-22-26(25-39)23-30(24-28)41-37-16-9-6-13-33(37)34-14-7-10-17-38(34)41/h3,5-24H,4H2,1-2H3/b11-3- |
| InChIKey | VAHDVXZZYYJGET-JYOAFUTRSA-N |
| XLogP | 9.86 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |