C17H23N5 — CID 143424368
[(E)-3-[3-methyl-1-[2-(methylamino)ethyl]-2,9-dihydrocyclohepta[b]pyrazin-6-yl]prop-2-enyl]cyanamide (PubChem CID 143424368) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is [(E)-3-[3-methyl-1-[2-(methylamino)ethyl]-2,9-dihydrocyclohepta[b]pyrazin-6-yl]prop-2-enyl]cyanamide.
| Compound Name | [(E)-3-[3-methyl-1-[2-(methylamino)ethyl]-2,9-dihydrocyclohepta[b]pyrazin-6-yl]prop-2-enyl]cyanamide |
|---|---|
| PubChem CID | 143424368 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | [(E)-3-[3-methyl-1-[2-(methylamino)ethyl]-2,9-dihydrocyclohepta[b]pyrazin-6-yl]prop-2-enyl]cyanamide |
| SMILES | CNCCN1CC(C)=NC2=C1CC=CC(/C=C/CNC#N)=C2 |
| InChI | InChI=1S/C17H23N5/c1-14-12-22(10-9-19-2)17-7-3-5-15(11-16(17)21-14)6-4-8-20-13-18/h3-6,11,19-20H,7-10,12H2,1-2H3/b6-4+ |
| InChIKey | VISNHCULMAAMRZ-GQCTYLIASA-N |
| XLogP | 1.71 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|