C29H44N4 — CID 142198855
(3Z,5Z,7E,9Z)-5-[4-[(tert-butylamino)methyl]-2-methyl-2H-pyridin-1-yl]-7-ethenyl-10-methyl-4-(propan-2-ylideneamino)dodeca-1,3,5,7,9-pentaen-6-amine (PubChem CID 142198855) has the molecular formula C29H44N4 and a molecular weight of 448.70 g/mol. Its IUPAC name is (3Z,5Z,7E,9Z)-5-[4-[(tert-butylamino)methyl]-2-methyl-2H-pyridin-1-yl]-7-ethenyl-10-methyl-4-(propan-2-ylideneamino)dodeca-1,3,5,7,9-pentaen-6-amine.
| Compound Name | (3Z,5Z,7E,9Z)-5-[4-[(tert-butylamino)methyl]-2-methyl-2H-pyridin-1-yl]-7-ethenyl-10-methyl-4-(propan-2-ylideneamino)dodeca-1,3,5,7,9-pentaen-6-amine |
|---|---|
| PubChem CID | 142198855 |
| Molecular Formula | C29H44N4 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | (3Z,5Z,7E,9Z)-5-[4-[(tert-butylamino)methyl]-2-methyl-2H-pyridin-1-yl]-7-ethenyl-10-methyl-4-(propan-2-ylideneamino)dodeca-1,3,5,7,9-pentaen-6-amine |
| SMILES | C=C/C=C(N=C(C)C)/C(=C(N)\C(C=C)=C\C=C(\C)CC)N1C=CC(CNC(C)(C)C)=CC1C |
| InChI | InChI=1S/C29H44N4/c1-11-14-26(32-21(4)5)28(27(30)25(13-3)16-15-22(6)12-2)33-18-17-24(19-23(33)7)20-31-29(8,9)10/h11,13-19,23,31H,1,3,12,20,30H2,2,4-10H3/b22-15-,25-16+,26-14-,28-27- |
| InChIKey | HJPUEYXZFFBDHF-KHVGFLIRSA-N |
| XLogP | 6.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|