C20H34N4O2 — CID 143424498
(E)-3-[3-amino-4-[2-[butyl(ethyl)amino]ethyl-propylamino]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 143424498) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is (E)-3-[3-amino-4-[2-[butyl(ethyl)amino]ethyl-propylamino]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-amino-4-[2-[butyl(ethyl)amino]ethyl-propylamino]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 143424498 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | (E)-3-[3-amino-4-[2-[butyl(ethyl)amino]ethyl-propylamino]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCCCN(CC)CCN(CCC)c1ccc(/C=C/C(=O)NO)cc1N |
| InChI | InChI=1S/C20H34N4O2/c1-4-7-13-23(6-3)14-15-24(12-5-2)19-10-8-17(16-18(19)21)9-11-20(25)22-26/h8-11,16,26H,4-7,12-15,21H2,1-3H3,(H,22,25)/b11-9+ |
| InChIKey | IQTRCCIHSSERQM-PKNBQFBNSA-N |
| XLogP | 3.13 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|